N-methyl-1-phenylmethanimine
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Prokaryota | Escherichia Coli | Columbia sheep blood | TD/GC-MS and MCC-IMS | no |
|
3-methyl-N-(3-methylbutyl)butan-1-imine
| Species emitting the compound | |
| Method | |
1-phenyl-N-propylmethanimine
Compound Details
| Synonymous names |
| Propylamine, N-benzylidene- | | 1-Propanamine, N-(phenylmethylene)- | | 1-phenyl-N-propylmethanimine | | N-Propylbenzylideneimine | | 6852-55-7 | | N-Benzylidenepropylamine | | T2W67C4NZ6 | | Benzylidene-propyl-amine | | Propylamine, N-benzylidene-, (E)- | | N-Benzylidenepropan-1-amine | | UNII-T2W67C4NZ6 | | (N(E))-N-(Phenylmethylene)-1-propanamine | | 1-Propanamine, N-(phenylmethylene)-, (E)- | | 1-Propanamine, N-(phenylmethylene)-, (N(E))- | | NSC 69424 | | NSC-69424 | | 27845-48-3 | | N-(Phenylmethylidene)-1-propanamine | | NSC69424 | | NCIOpen2_000375 | | SCHEMBL5235095 | | SCHEMBL6289914 | | DTXSID70290552 | | DFROALYLRQTARX-PKNBQFBNSA-N | | DFROALYLRQTARX-UHFFFAOYSA-N | | N-(phenylmethylene)-1-propanamine | | AKOS006346534 | | AKOS024332522 |
|
| Microorganism: | Yes |
| IUPAC name | 1-phenyl-N-propylmethanimine |
| SMILES | CCCN=CC1=CC=CC=C1 |
| Inchi | InChI=1S/C10H13N/c1-2-8-11-9-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3 |
| Formula | C10H13N |
| PubChem ID | 250250 |
|
| Molweight | 147.22 |
| LogP | 2.5 |
| Atoms | 11 |
| Bonds | 3 |
| H-bond Acceptor | 1 |
| H-bond Donor | 0 |
| Chemical Classification | aromatic compounds imines benzenoids nitrogen compounds |
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Prokaryota | Escherichia Coli | Columbia sheep blood | TD/GC-MS and MCC-IMS | no |
|
6-tert-butyl-2,3,4,5-tetrahydropyridine
Compound Details
| Synonymous names |
| 6-tert-Butyl-2,3,4,5-tetrahydropyridine | | 90949-17-0 | | 2-tert-Butyl-3,4,5,6-tetrahydropyridine | | SCHEMBL13024476 | | DTXSID70338049 | | GYOXQZZYNAPKIQ-UHFFFAOYSA-N | | 6-tert-Butyl-2,3,4,5-tetrahydropyridine # |
|
| Microorganism: | Yes |
| IUPAC name | 6-tert-butyl-2,3,4,5-tetrahydropyridine |
| SMILES | CC(C)(C)C1=NCCCC1 |
| Inchi | InChI=1S/C9H17N/c1-9(2,3)8-6-4-5-7-10-8/h4-7H2,1-3H3 |
| Formula | C9H17N |
| PubChem ID | 546050 |
|
| Molweight | 139.24 |
| LogP | 1.8 |
| Atoms | 10 |
| Bonds | 1 |
| H-bond Acceptor | 1 |
| H-bond Donor | 0 |
| Chemical Classification | imines heterocyclic compounds nitrogen compounds |
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Eukaryota | Saccharomyces Cerevisiae | malt extract broth | HS-SPME with GC-MS | no |
|
2-hydroxypyridazin-3-imine
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Aspergillus Flavus | inoculated potato samples | GC-MS | no |
|
N-(3-methylbutyl)-2-phenylethanimine
| Species emitting the compound | |
| Method | |
3-hydroxy-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-imine
Compound Details
| Synonymous names |
| 2-Imino-5,6-dihydro-2H-cyclopenta[d][1,3]thiazol-3(4H)-ol | | 738528-09-1 | | DTXSID40873311 | | WLQKCALWPCEPQY-UHFFFAOYSA-N | | 2H-Cyclopentathiazol-2-imine, 3,4,5,6-tetrahydro-3-hydroxy- | | 2-Imino-5,6-dihydro-2H-cyclopenta[d][1,3]thiazol-3(4H)-ol # |
|
| Microorganism: | No |
| IUPAC name | 3-hydroxy-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-imine |
| SMILES | C1CC2=C(C1)SC(=N)N2O |
| Inchi | InChI=1S/C6H8N2OS/c7-6-8(9)4-2-1-3-5(4)10-6/h7,9H,1-3H2 |
| Formula | C6H8N2OS |
| PubChem ID | 587462 |
|
| Molweight | 156.21 |
| LogP | 0.7 |
| Atoms | 10 |
| Bonds | 0 |
| H-bond Acceptor | 3 |
| H-bond Donor | 2 |
| Chemical Classification | heterocyclic compounds imines nitrogen compounds sulfur compounds thiazoles |
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Aspergillus Flavus | inoculated potato samples | GC-MS | no |
|
1-methyl-1-(2-methylphenyl)-2-(2-oxochromen-6-yl)guanidine
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Aspergillus Flavus | inoculated potato samples | GC-MS | no |
|
4-[(5-bromothiophen-2-yl)methylideneamino]benzamide
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Aspergillus Flavus | inoculated potato samples | GC-MS | no |
|
[7-bromo-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] Acetate
Compound Details
| Synonymous names |
| 3-Hydroxyphenazepam Acetate | | 7-Bromo-5-(2-chlorophenyl)-2-oxo-2,3-dihydro-1H-1,4-benzodiazepin-3-yl acetate | | 70030-10-3 | | ZINC00970070 | | Oprea1_550210 | | MLS001012264 | | CHEMBL1517541 | | WFNOHKYMHSJTSM-UHFFFAOYSA-N | | HMS2780L19 | | STK862143 | | AKOS002312870 | | AKOS016116821 | | SMR000425068 | | 2H-1,4-Benzodiazepin-2-one, 3-(acetyloxy)-7-bromo-5-(2-chlorophenyl)-1,3-dihydro- | | 7-Bromo-5-(2-chlorophenyl)-2-oxo-2,3-dihydro-1H-1,4-benzodiazepin-3-yl acetate # | | Acetic acid 7-bromo-5-(2-chloro-phenyl)-2-oxo-2,3-dihydro-1H-benzo[e][1,4]diazepin-3-yl ester |
|
| Microorganism: | No |
| IUPAC name | [7-bromo-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate |
| SMILES | CC(=O)OC1C(=O)NC2=C(C=C(C=C2)Br)C(=N1)C3=CC=CC=C3Cl |
| Inchi | InChI=1S/C17H12BrClN2O3/c1-9(22)24-17-16(23)20-14-7-6-10(18)8-12(14)15(21-17)11-4-2-3-5-13(11)19/h2-8,17H,1H3,(H,20,23) |
| Formula | C17H12BrClN2O3 |
| PubChem ID | 630731 |
|
| Molweight | 407.6 |
| LogP | 3 |
| Atoms | 24 |
| Bonds | 3 |
| H-bond Acceptor | 4 |
| H-bond Donor | 1 |
| Chemical Classification | amides aromatic compounds benzenoids bromides chlorides esters halogenated compounds heterocyclic compounds imines |
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Aspergillus Flavus | inoculated potato samples | GC-MS | no |
|
14,20-bis(methylsulfanyl)-24-azapentacyclo[10.9.2.115,19.02,11.04,9]tetracosa-1(22),2,4,6,8,10,12(23),15,17,19(24)-decaene
Compound Details
| Synonymous names |
| QGZMVHKVOPPBGC-UHFFFAOYSA-N | | 6,16-Etheno-13,9-nitrilo-9H-cyclotrideca[b]naphthalene, 7,8,14,15-tetrahydro-8,14-bis(methylthio)- |
|
| Microorganism: | No |
| IUPAC name | 14,20-bis(methylsulfanyl)-24-azapentacyclo[10.9.2.115,19.02,11.04,9]tetracosa-1(22),2,4,6,8,10,12(23),15,17,19(24)-decaene |
| SMILES | CSC1CC2=CC=C(CC(C3=CC=CC1=N3)SC)C4=CC5=CC=CC=C5C=C24 |
| Inchi | InChI=1S/C25H23NS2/c1-27-24-14-18-10-11-19(15-25(28-2)23-9-5-8-22(24)26-23)21-13-17-7-4-3-6-16(17)12-20(18)21/h3-13,24-25H,14-15H2,1-2H3 |
| Formula | C25H23NS2 |
| PubChem ID | 634067 |
|
| Molweight | 401.6 |
| LogP | 6.1 |
| Atoms | 28 |
| Bonds | 2 |
| H-bond Acceptor | 3 |
| H-bond Donor | 0 |
| Chemical Classification | aromatic compounds benzenoids imines nitrogen compounds sulfur compounds thioethers |
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Aspergillus Niger | inoculated potato samples | GC-MS | no |
|
1-cyclohexyl-6-hydroxy-5-(2-piperazin-1-ylethyliminomethyl)pyrimidine-2,4-dione
Compound Details
| Synonymous names |
| FWFBVFMJVPCPAR-WYMLVPIESA-N | | STL337344 | | AKOS022138922 | | MCULE-3156459122 | | Pyrimidine-2,4,6-trione, 1-cyclohexyl-5-[(2-piperazin-1-yl-ethylamino)methylene]- | | (5E)-1-cyclohexyl-5-({[2-(piperazin-1-yl)ethyl]amino}methylidene)pyrimidine-2,4,6(1H,3H,5H)-trione |
|
| Microorganism: | Yes |
| IUPAC name | 1-cyclohexyl-6-hydroxy-5-(2-piperazin-1-ylethyliminomethyl)pyrimidine-2,4-dione |
| SMILES | C1CCC(CC1)N2C(=C(C(=O)NC2=O)C=NCCN3CCNCC3)O |
| Inchi | InChI=1S/C17H27N5O3/c23-15-14(12-19-8-11-21-9-6-18-7-10-21)16(24)22(17(25)20-15)13-4-2-1-3-5-13/h12-13,18,24H,1-11H2,(H,20,23,25) |
| Formula | C17H27N5O3 |
| PubChem ID | 1845939 |
|
| Molweight | 349.4 |
| LogP | 0 |
| Atoms | 25 |
| Bonds | 5 |
| H-bond Acceptor | 6 |
| H-bond Donor | 3 |
| Chemical Classification | pyrimidines piperazines amides nitrogen compounds alcohols amines imines |
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Eukaryota | Saccharomyces Cerevisiae | malt extract broth | HS-SPME with GC-MS | no |
|
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Aspergillus Flavus | inoculated potato samples | GC-MS | no |
|
N-(3-methylbutyl)-1-phenylmethanimine
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Prokaryota | Bacillus Popillae | n/a | n/a | no |
|
3-(2-phenylethylimino)butan-2-one
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Prokaryota | Staphylococcus Schleiferi | brain heart infusion medium | Porapak / GC/MS | yes |
|
N-methyl-N-[4-[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)amino]phenyl]acetamide
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Aspergillus Niger | inoculated potato samples | GC-MS | no |
|
1-N',2-N'-bis(2-chlorophenyl)-1-N,2-N-dihydroxyethanediimidamide
Compound Details
| Synonymous names |
| PABLIIZYRHGLJB-UHFFFAOYSA-N | | STL575088 | | AKOS001710166 | | Aminoglyoxime, N,N'-bis(2-chlorophenyl)- | | (1Z,2Z)-N~1~,N~2~-bis(2-chlorophenyl)-N'~1~,N'~2~-dihydroxyethanediimidamide |
|
| Microorganism: | No |
| IUPAC name | 1-N',2-N'-bis(2-chlorophenyl)-1-N,2-N-dihydroxyethanediimidamide |
| SMILES | C1=CC=C(C(=C1)N=C(C(=NC2=CC=CC=C2Cl)NO)NO)Cl |
| Inchi | InChI=1S/C14H12Cl2N4O2/c15-9-5-1-3-7-11(9)17-13(19-21)14(20-22)18-12-8-4-2-6-10(12)16/h1-8,21-22H,(H,17,19)(H,18,20) |
| Formula | C14H12Cl2N4O2 |
| PubChem ID | 135496947 |
|
| Molweight | 339.2 |
| LogP | 4.3 |
| Atoms | 22 |
| Bonds | 5 |
| H-bond Acceptor | 4 |
| H-bond Donor | 4 |
| Chemical Classification | aromatic compounds benzenoids chlorides halogenated compounds imines nitrogen compounds oximes |
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Aspergillus Niger | inoculated potato samples | GC-MS | no |
|
2-[(E)-[3-(N,2-dimethylanilino)-1-benzofuran-2-yl]iminomethyl]phenol
| Species emitting the compound | |
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Eukaryota | Saccharomyces Cerevisiae | malt extract broth | HS-SPME with GC-MS | no |
|