Phthalsaeurediaethylester |
diethyl benzenedicarboxylate |
Diethylphthalate |
Diethyl o-phenylenediacetate |
Diethylester kyseliny ftalove |
DIETHYL PHTHALATE |
Diethyl phthalate/dimethyl phthalate |
FLKPEMZONWLCSK-UHFFFAOYSA-N |
Neantine |
Phthalol |
Solvanol |
Anozol |
diethyl phtalate |
Ethyl phthalate |
Phthalsaeurediaethylester [German] |
o-Benzenedicarboxylic acid diethyl ester |
Benzenedicarboxylic acid, diethyl ester |
Kodaflex DEP |
Palatinol A |
Phthalic acid diethyl |
Diethyl o-phthalate |
Diethyl-o-phthalate |
o-Bis(ethoxycarbonyl)benzene |
phthalic acid diethyl ester |
PHTHALIC ACID,DIETHYL ESTER |
Placidol E |
solvano l |
Unimoll DA |
AC1L1NAJ |
DEP NF |
o-Benzenedicarboxylic acid, diethyl ester |
Diethyl 1,2-benzenedicarboxylate |
Diethyl Phthalate Metal Plastic IBC/Tote |
Diethyl Phthalate NF NF Perfume |
Diethyl-1,2-benzenedicarboxylate |
AC1Q64KI |
Di-n-ethyl phthalate |
Diethylester kyseliny ftalove [Czech] |
DIETHYLPHTHALATE(RING-D4) |
Phthalic acid, diethyl ester |
ethyl 2-(ethoxycarbonyl)benzoate |
Diethyl Phthalate [USAN] |
KSC448E0D |
Phthalic acid diethyl ester, DEP|| |
ZINC1287 |
1,2-benzenedicarboxylic acid diethyl ester |
ACMC-20aj0r |
diethyl benzene-1,2-dicarboxylate |
Diethyl phthalate (NF) |
Diethyl phthalate [NF] |
Diethyl phthalate, >=99% |
NSC8905 |
SCHEMBL22296 |
1,2-Diethyl phthalate |
CTK3E8201 |
Diethyl phthalate, 99% |
Diethyl phthalate, European Pharmacopoeia (EP) Reference Standard |
HSDB 926 |
P0296 |
UF064M00AF |
BIDD:ER0639 |
CHEMBL388558 |
RP27382 |
A10802 |
bmse000846 |
C14175 |
CCRIS 2675 |
D03804 |
Diethyl ester of 1,2-Benzenedicarboxylic acid |
Diethyl phthalate, United States Pharmacopeia (USP) Reference Standard |
DPX-F5384 |
Estol 1550 |
HMS2233J05 |
HMS3369G01 |
RCRA waste number U088 |
UNII-UF064M00AF |
1,2-Benzenedicarboxylic acid, diethyl ester |
BBL011577 |
benzene-1,2-dicarboxylic acid diethyl ester |
Diethyl phthalate, PESTANAL(R), analytical standard |
Diethyl Phthalate, pharmaceutical secondary standard; traceable to USP, PhEur |
DTXSID7021780 |
LS-1838 |
NSC 8905 |
NSC-8905 |
OR015849 |
OR143544 |
OR328309 |
OR328310 |
OR328311 |
SBB060561 |
STL163320 |
ZB000300 |
CHEBI:34698 |
DSSTox_CID_1780 |
NCI-C60048 |
WLN: 2OVR BVO2 |
AJ-07993 |
AK-98162 |
AN-24076 |
ANW-75577 |
AX8124754 |
CC-26717 |
Diethyl phthalate, >=99.5% |
DSSTox_GSID_21780 |
ACN-S002427 |
BB_SC-7041 |
C-34265 |
Diethyl phthalate, 99.5% |
Diethyl phthalate, LR, >=99% |
DSSTox_RID_76323 |
MFCD00009111 |
ZINC00001287 |
AI3-00329 |
KB-251524 |
RTR-030992 |
ST24046564 |
ST50406385 |
TR-030992 |
AKOS000119867 |
Epitope ID:140105 |
I01-6179 |
Q-200982 |
RCRA waste no. U088 |
BRN 1912500 |
Diethyl Phthalate MIL-D-242 Mil Spec |
FT-0624802 |
MLS001336021 |
MLS001336022 |
MLS002152901 |
MLS002177800 |
SMR000857334 |
84-66-2 |
1,2-diethyl benzene-1,2-dicarboxylate |
Tox21_111050 |
Tox21_201874 |
Tox21_300183 |
3B1-009116 |
F1908-0104 |
CAS-84-66-2 |
Diethyl phthalate, SAJ special grade, >=98.0% |
MCULE-8221041887 |
NCGC00090974-01 |
NCGC00090974-02 |
NCGC00090974-03 |
NCGC00090974-04 |
NCGC00090974-05 |
NCGC00090974-06 |
NCGC00254098-01 |
NCGC00259423-01 |
1,2-Benzenedicarboxylic acid, 1,2-diethyl ester |
EINECS 201-550-6 |
EINECS 273-520-0 |
68988-18-1 |
MolPort-003-905-624 |
1,2-Benzenedicarboxylic acid, di-C4-13-alkyl esters |
Diethylphthalate, A-A-59314, JAN-D-242 |
4-09-00-03172 (Beilstein Handbook Reference) |
InChI=1/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H |