Synonymous names |
dimehtylformarnide | dimethylformarnide | dimethylforrnamide | dirnethylformamide | dirnethylformarnide | Formyldimethylamine | dimethyiformamide | Dimethylforamide | Dimethylformamid | Dimethylformamide | Dimetilformamide | dimetylformamide | Dimetylformamidu | Dwumetyloformamid | dimethy1formamide | Dimethylamid kyseliny mravenci | N-Formyldimethylamine | di-methylformamide | Dimethyl formamide | dimethyl-Formamide | dimethylf ormamide | dimethylform amide | dimethylform-amide | dimethylformamid e | Dimethylformamide Reagent Grade ACS | dimethylformamide- | ZMXDDKWLCZADIW-UHFFFAOYSA-N | N,N-Dimethylformaldehyde | Dimethylformamide, DMF | DMFA | N,N-dimethylformarnide | N,N-dimethylforrnamide | N,N-Dimethylmethanamide | N,N-dirnethylformamide | N,N'-Dimethylformamide | DMF | N,N Dimethylformamide | N,N-Dimethylformamid | N,N-DIMETHYLFORMAMIDE | N,N-Dimethylformamide, Spectrophotometric Grade | N,N-Dimetilformamida | N,N-dimetylformamide | n,n,dimethylformamide | N.N-dimethylformamide | dimethyl form-amide | dimethyl- formamide | dimethylfor- mamide | 1N,N-dimethylformamide | Dimethylformamid [German] | Dimethylformamide, pharmaceutical secondary standard; traceable to USP | Dimetilformamide [Italian] | Dwumetyloformamid [Polish] | Dimetylformamidu [Czech] | DMF (dimethylformamide) | N,N-di-methylforrnamide | N,N-Dimethylformamide HPLC grade | N,N-Dimethylformamide, analytical standard | N,N-Dimethylformamide, anhydrous | Formamide,N-dimethyl- | N, N dimethylformamide | N, N-dimethylformamide | N,N -dimethylformamide | N,N dimethyl formamide | N,N- Dimethylformamide | N,N-di methylformamide | N,N-di-methylformamide | N,N-dime-thylformamide | N,N-dimehtyl formamide | N,N-dimethyl formamid | N,N-Dimethyl formamide | n,n-dimethyl-Formamide | N,N-dimethylfor mamide | N,N-dimethylfor-mamide | N,N-dimethylform-amide | N,N-dimethylformamide- | N,N-dimetyl formamide | AC1L1M2O | Dimethylamid kyseliny mravenci [Czech] | formamide, dimethyl- | N,N-DIMETHYLFORMAMIDE, ACS | AC1Q3W44 | HSDB 78 | K124 | KSC352S1B | N,N-Dimethylformamide, HPLC Grade | Dimethylformamide, N,N- | N, N- dimethylformamide | N, N-di-methylformamide | N, N-dimethyl formamide | N,N- dimethyl formamide | N,N-di-methyl formamide | N,N-di-methyl-formamide | N,N-dimethyl- formamide | N,N-Dimethylformamide, ACS grade | NSC5356 | PubChem23341 | UN2265 | CTK2F2910 | D0722 | D0939 | DMF (amide) | FORMIN ACID,AMIDE,N,N-DIMETHYL | HMDB01888 | N,N-Dimetilformamida [Spanish] | BIDD:ER0600 | CHEMBL268291 | DB01844 | DIMETHYLFORMAMIDE 99% (PEPTIDE GRADE) | DMF-d7; Heptadeutero-N,N-dimethylformamide | HCON(CH3)2 | RL04602 | RP18321 | WLN: VHN1&1 | 8696NH0Y2X | bmse000709 | C03134 | CCRIS 1638 | Dimethyl formamide-Formamide, N,N-dimethyl- | DSSTox_CID_515 | LTBB002011 | N,N-Dimethylformamide, anhydrous, amine free | ZINC901648 | BC206707 | Dimethylformamide, n,n- Reagent Grade ACS | DTXSID6020515 | Formamide, N,N-dimethyl- | LS-1577 | NSC 5356 | NSC-5356 | OR000145 | OR326828 | STL264197 | UN 2265 | ZB015299 | 300076X | A836012 | ACMC-20976q | CHEBI:17741 | NCI-C60913 | U-4224 | UNII-8696NH0Y2X | AB1007264 | AN-23775 | ANW-13584 | Caswell No. 366A | CJ-04552 | DSSTox_GSID_20515 | EBD2222506 | SC-18318 | DSSTox_RID_75636 | MFCD00003284 | ZINC00901648 | AI3-03311 | RTR-037473 | TR-037473 | AKOS000121096 | EPA Pesticide Chemical Code 366200 | I14-0843 | N,N-Dimethylformamide, 99.8% | N,N-Dimethylformamide, for molecular biology, >=99% | N,N-Dimethylformamide, LR, >=99% | FT-0629532 | FT-0639029 | 68-12-2 | Dynasolve 100 (Salt/Mix) | N,N-Dimethylformamide, ACS spectrophotometric grade, >=99.8% | N,N-Dimethylformamide, ReagentPlus(R), >=99% | Tox21_201259 | Tox21_300039 | Formic acid, amide, N,N-dimethyl- | N,N-Dimethylformamide, anhydrous, 99.8% | CAS-68-12-2 | MCULE-6290117712 | N,N-Dimethylformamide, ACS reagent, >=99.8% | N,N-Dimethylformamide, AR, >=99.5% | NCGC00090785-01 | NCGC00090785-02 | NCGC00090785-03 | NCGC00090785-04 | NCGC00090785-05 | NCGC00254093-01 | NCGC00258811-01 | EINECS 200-679-5 | N,N-Dimethylformamide, 99% 250ml | N,N-Dimethylformamide, B&J Brand (product of Burdick & Jackson) | N,N-Dimethylformamide, UV HPLC spectroscopic, 99.7% | 15175-63-0 | 15175-77-6 | 33513-42-7 | N,N-Dimethylformamide, for HPLC, >=99.5% | N,N-Dimethylformamide, for HPLC, >=99.9% | N,N-Dimethylformamide, JIS special grade, >=99.5% | 191-EP1441224A2 | 191-EP2269610A2 | 191-EP2269975A2 | 191-EP2269977A2 | 191-EP2269978A2 | 191-EP2269979A1 | 191-EP2269985A2 | 191-EP2269988A2 | 191-EP2269989A1 | 191-EP2269990A1 | 191-EP2269991A2 | 191-EP2269992A1 | 191-EP2269993A1 | 191-EP2269994A1 | 191-EP2269997A2 | 191-EP2270001A1 | 191-EP2270003A1 | 191-EP2270004A1 | 191-EP2270005A1 | 191-EP2270006A1 | 191-EP2270008A1 | 191-EP2270009A1 | 191-EP2270010A1 | 191-EP2270011A1 | 191-EP2270012A1 | 191-EP2270013A1 | 191-EP2270014A1 | 191-EP2270015A1 | 191-EP2270018A1 | 191-EP2272509A1 | 191-EP2272516A2 | 191-EP2272517A1 | 191-EP2272537A2 | 191-EP2272813A2 | 191-EP2272822A1 | 191-EP2272825A2 | 191-EP2272826A1 | 191-EP2272827A1 | 191-EP2272828A1 | 191-EP2272832A1 | 191-EP2272834A1 | 191-EP2272835A1 | 191-EP2272838A1 | 191-EP2272839A1 | 191-EP2272840A1 | 191-EP2272841A1 | 191-EP2272843A1 | 191-EP2272845A2 | 191-EP2272848A1 | 191-EP2272972A1 | 191-EP2272973A1 | 191-EP2274983A1 | 191-EP2275102A1 | 191-EP2275105A1 | 191-EP2275401A1 | 191-EP2275409A1 | 191-EP2275410A1 | 191-EP2275411A2 | 191-EP2275412A1 | 191-EP2275413A1 | 191-EP2275414A1 | 191-EP2275415A2 | 191-EP2275416A1 | 191-EP2275420A1 | 191-EP2275422A1 | 191-EP2275423A1 | 191-EP2275425A1 | 191-EP2275469A1 | 191-EP2277848A1 | 191-EP2277858A1 | 191-EP2277861A1 | 191-EP2277865A1 | 191-EP2277866A1 | 191-EP2277867A2 | 191-EP2277868A1 | 191-EP2277869A1 | 191-EP2277870A1 | 191-EP2277872A1 | 191-EP2277874A1 | 191-EP2277875A2 | 191-EP2277877A1 | 191-EP2277878A1 | 191-EP2277882A1 | 191-EP2277945A1 | 191-EP2279741A2 | 191-EP2279750A1 | 191-EP2280001A1 | 191-EP2280003A2 | 191-EP2280006A1 | 191-EP2280008A2 | 191-EP2280009A1 | 191-EP2280010A2 | 191-EP2280012A2 | 191-EP2280014A2 | 191-EP2281563A1 | 191-EP2281810A1 | 191-EP2281812A1 | 191-EP2281813A1 | 191-EP2281815A1 | 191-EP2281819A1 | 191-EP2281822A1 | 191-EP2281823A2 | 191-EP2281861A2 | 191-EP2284148A1 | 191-EP2284149A1 | 191-EP2284150A2 | 191-EP2284151A2 | 191-EP2284152A2 | 191-EP2284153A2 | 191-EP2284154A1 | 191-EP2284155A2 | 191-EP2284156A2 | 191-EP2284157A1 | 191-EP2284160A1 | 191-EP2284164A2 | 191-EP2284166A1 | 191-EP2284169A1 | 191-EP2284171A1 | 191-EP2284172A1 | 191-EP2284174A1 | 191-EP2284178A2 | 191-EP2284179A2 | 191-EP2286811A1 | 191-EP2286812A1 | 191-EP2286915A2 | 191-EP2287140A2 | 191-EP2287148A2 | 191-EP2287150A2 | 191-EP2287156A1 | 191-EP2287161A1 | 191-EP2287162A1 | 191-EP2287164A1 | 191-EP2287165A2 | 191-EP2287166A2 | 191-EP2287167A1 | 191-EP2287168A2 | 191-EP2289483A1 | 191-EP2289510A1 | 191-EP2289871A1 | 191-EP2289876A1 | 191-EP2289881A1 | 191-EP2289883A1 | 191-EP2289886A1 | 191-EP2289890A1 | 191-EP2289891A2 | 191-EP2289892A1 | 191-EP2289893A1 | 191-EP2289894A2 | 191-EP2292088A1 | 191-EP2292228A1 | 191-EP2292589A1 | 191-EP2292590A2 | 191-EP2292593A2 | 191-EP2292595A1 | 191-EP2292597A1 | 191-EP2292606A1 | 191-EP2292611A1 | 191-EP2292613A1 | 191-EP2292615A1 | 191-EP2292617A1 | 191-EP2292619A1 | 191-EP2292620A2 | 191-EP2292621A1 | 191-EP2292625A1 | 191-EP2292628A2 | 191-EP2295053A1 | 191-EP2295401A2 | 191-EP2295402A2 | 191-EP2295406A1 | 191-EP2295407A1 | 191-EP2295409A1 | 191-EP2295410A1 | 191-EP2295411A1 | 191-EP2295412A1 | 191-EP2295413A1 | 191-EP2295414A1 | 191-EP2295415A1 | 191-EP2295416A2 | 191-EP2295417A1 | 191-EP2295418A1 | 191-EP2295419A2 | 191-EP2295426A1 | 191-EP2295427A1 | 191-EP2295428A2 | 191-EP2295429A1 | 191-EP2295432A1 | 191-EP2295433A2 | 191-EP2295434A2 | 191-EP2295435A1 | 191-EP2295437A1 | 191-EP2295439A1 | 191-EP2295503A1 | 191-EP2298312A1 | 191-EP2298728A1 | 191-EP2298731A1 | 191-EP2298734A2 | 191-EP2298735A1 | 191-EP2298736A1 | 191-EP2298742A1 | 191-EP2298743A1 | 191-EP2298744A2 | 191-EP2298745A1 | 191-EP2298747A1 | 191-EP2298748A2 | 191-EP2298749A1 | 191-EP2298750A1 | 191-EP2298755A1 | 191-EP2298758A1 | 191-EP2298759A1 | 191-EP2298761A1 | 191-EP2298762A2 | 191-EP2298764A1 | 191-EP2298765A1 | 191-EP2298768A1 | 191-EP2298770A1 | 191-EP2298774A1 | 191-EP2298775A1 | 191-EP2298776A1 | 191-EP2298779A1 | 191-EP2298780A1 | 191-EP2298783A1 | 191-EP2301534A1 | 191-EP2301536A1 | 191-EP2301538A1 | 191-EP2301544A1 | 191-EP2301909A1 | 191-EP2301912A2 | 191-EP2301916A2 | 191-EP2301918A1 | 191-EP2301921A1 | 191-EP2301922A1 | 191-EP2301923A1 | 191-EP2301925A1 | 191-EP2301926A1 | 191-EP2301928A1 | 191-EP2301929A1 | 191-EP2301930A1 | 191-EP2301931A1 | 191-EP2301932A1 | 191-EP2301933A1 | 191-EP2301935A1 | 191-EP2301936A1 | 191-EP2301937A1 | 191-EP2301939A1 | 191-EP2301940A1 | 191-EP2301983A1 | 191-EP2305250A1 | 191-EP2305254A1 | 191-EP2305627A1 | 191-EP2305636A1 | 191-EP2305637A2 | 191-EP2305640A2 | 191-EP2305641A1 | 191-EP2305643A1 | 191-EP2305644A1 | 191-EP2305647A1 | 191-EP2305648A1 | 191-EP2305652A2 | 191-EP2305658A1 | 191-EP2305659A1 | 191-EP2305660A1 | 191-EP2305664A1 | 191-EP2305666A1 | 191-EP2305667A2 | 191-EP2305668A1 | 191-EP2305671A1 | 191-EP2305672A1 | 191-EP2305674A1 | 191-EP2305675A1 | 191-EP2305676A1 | 191-EP2305677A1 | 191-EP2305679A1 | 191-EP2305681A1 | 191-EP2305682A1 | 191-EP2305684A1 | 191-EP2305687A1 | 191-EP2305688A1 | 191-EP2305689A1 | 191-EP2305695A2 | 191-EP2305696A2 | 191-EP2305697A2 | 191-EP2305698A2 | 191-EP2305769A2 | 191-EP2305808A1 | 191-EP2308479A2 | 191-EP2308812A2 | 191-EP2308832A1 | 191-EP2308833A2 | 191-EP2308838A1 | 191-EP2308840A1 | 191-EP2308841A2 | 191-EP2308844A2 | 191-EP2308845A2 | 191-EP2308846A2 | 191-EP2308848A1 | 191-EP2308849A1 | 191-EP2308851A1 | 191-EP2308855A1 | 191-EP2308857A1 | 191-EP2308861A1 | 191-EP2308866A1 | 191-EP2308867A2 | 191-EP2308869A1 | 191-EP2308870A2 | 191-EP2308872A1 | 191-EP2308873A1 | 191-EP2308874A1 | 191-EP2308875A1 | 191-EP2308876A1 | 191-EP2308879A1 | 191-EP2308880A1 | 191-EP2308882A1 | 191-EP2308883A1 | 191-EP2308960A1 | 191-EP2311451A1 | 191-EP2311455A1 | 191-EP2311464A1 | 191-EP2311494A1 | 191-EP2311796A1 | 191-EP2311797A1 | 191-EP2311798A1 | 191-EP2311799A1 | 191-EP2311805A1 | 191-EP2311806A2 | 191-EP2311807A1 | 191-EP2311808A1 | 191-EP2311810A1 | 191-EP2311815A1 | 191-EP2311818A1 | 191-EP2311824A1 | 191-EP2311825A1 | 191-EP2311826A2 | 191-EP2311827A1 | 191-EP2311829A1 | 191-EP2311830A1 | 191-EP2311831A1 | 191-EP2311837A1 | 191-EP2311838A1 | 191-EP2311840A1 | 191-EP2311842A2 | 191-EP2311850A1 | 191-EP2314295A1 | 191-EP2314575A1 | 191-EP2314576A1 | 191-EP2314577A1 | 191-EP2314580A1 | 191-EP2314581A1 | 191-EP2314582A1 | 191-EP2314583A1 | 191-EP2314584A1 | 191-EP2314586A1 | 191-EP2314590A1 | 191-EP2314593A1 | 191-EP2315303A1 | 191-EP2315502A1 | 191-EP2316450A1 | 191-EP2316452A1 | 191-EP2316457A1 | 191-EP2316458A1 | 191-EP2316470A2 | 191-EP2316824A1 | 191-EP2316825A1 | 191-EP2316827A1 | 191-EP2316828A1 | 191-EP2316829A1 | 191-EP2316830A2 | 191-EP2316831A1 | 191-EP2316832A1 | 191-EP2316833A1 | 191-EP2316834A1 | 191-EP2316835A1 | 191-EP2316836A1 | 191-EP2316905A1 | 191-EP2316906A2 | 191-EP2371797A1 | 191-EP2371798A1 | 191-EP2371800A1 | 191-EP2371804A1 | 191-EP2371808A1 | 191-EP2371812A1 | 191-EP2371814A1 | 191-EP2374454A1 | 191-EP2374790A1 | 191-EP2374791A1 | 191-EP2374895A1 | 191-EP2380873A1 | 192-EP2275418A1 | 192-EP2275420A1 | 192-EP2277565A2 | 192-EP2277566A2 | 192-EP2277567A1 | 192-EP2277568A2 | 192-EP2277569A2 | 192-EP2277570A2 | 192-EP2277875A2 | 192-EP2277945A1 | 192-EP2279741A2 | 192-EP2280008A2 | 192-EP2280012A2 | 192-EP2281815A1 | 192-EP2284172A1 | 192-EP2286811A1 | 192-EP2289894A2 | 192-EP2292280A1 | 192-EP2292600A1 | 192-EP2292624A1 | 192-EP2292628A2 | 192-EP2295055A2 | 192-EP2295408A1 | 192-EP2295416A2 | 192-EP2295426A1 | 192-EP2295427A1 | 192-EP2295437A1 | 192-EP2298738A1 | 192-EP2298743A1 | 192-EP2298748A2 | 192-EP2298770A1 | 192-EP2298775A1 | 192-EP2298776A1 | 192-EP2301911A1 | 192-EP2301924A1 | 192-EP2301926A1 | 192-EP2305250A1 | 192-EP2305642A2 | 192-EP2305658A1 | 192-EP2305667A2 | 192-EP2308479A2 | 192-EP2308833A2 | 192-EP2308842A1 | 192-EP2308874A1 | 192-EP2311453A1 | 192-EP2311815A1 | 192-EP2311818A1 | 192-EP2311820A1 | 192-EP2314295A1 | 192-EP2314581A1 | 192-EP2380874A2 | EC 200-679-5 | N,N-Dimethylformamide, biotech. grade, >=99.9% | N,N-Dimethylformamide, SAJ first grade, >=99.0% | 114057-15-7 | N,N-Dimethylformamide [UN2265] [Flammable liquid] | MolPort-000-871-967 | N,N-Dimethylformamide, AldraSORB(TM), 99.8% | 14869-EP2272846A1 | 14869-EP2277868A1 | 14869-EP2277869A1 | 14869-EP2277870A1 | 14869-EP2284178A2 | 14869-EP2284179A2 | 14869-EP2287164A1 | 14869-EP2292608A1 | 14869-EP2298305A1 | 14869-EP2305033A1 | 14869-EP2308866A1 | 14869-EP2308878A2 | 14869-EP2314580A1 | 14869-EP2316830A2 | 70936-EP2269990A1 | 70936-EP2277945A1 | 70936-EP2281815A1 | 70936-EP2295425A1 | 70936-EP2295426A1 | 70936-EP2295427A1 | 70936-EP2298743A1 | 70936-EP2308833A2 | 70936-EP2374788A1 | N,N-Dimethylformamide, suitable for neutral marker for measuring electroosmotic flow (EOF), ~99% | N,N-Dimethylformamide [UN2265] [Flammable liquid] | N,N-Dimethylformamide, p.a., 99.8% | N,N-Dimethylformamide, Vetec(TM) reagent grade, anhydrous, >=99.8% | N,N-Dimethylformamide HPLC, UV-IR min. 99.9%, isocratic grade | N,N-Dimethylformamide, p.a., ACS reagent, 99.8% | InChI=1/C3H7NO/c1-4(2)3-5/h3H,1-2H | N,N-Dimethylformamide, p.a., ACS reagent, reag. ISO, reag. Ph. Eur., 99.8% | N,N-Dimethylformamide, puriss. p.a., ACS reagent, reag. Ph. Eur., >=99.8% (GC) |
|