Essigsaeurebutylester |
Butylacetaten |
Butylacetat |
Butylazetat |
Butylester kyseliny octove |
DKPFZGUDAPQIHT-UHFFFAOYSA-N |
Butyl ethanoate |
Essigsaeure-n-butylester |
Butyl acetate |
inverted exclamation mark currency Butile |
normal-butyl acetate |
1-acetoxybutane |
1-Butylacetate |
8JZ |
AC1L1LAD |
Acetate de butyle |
acetic acid butyl |
Butyl acetate, analytical standard |
n-Butyl ethanoate |
Acetic Acid Butyl Ester |
ACETIC ACID,BUTYL ESTER |
ACMC-1BOEJ |
N-BUTYL ACETATE |
Octan n-butylu |
Butyl Acetate Reagent ACS Grade |
Butylacetaten [Dutch] |
1-Butyl acetate |
Butylacetat [German] |
Butile(acetati di) |
Butyl ester of acetic acid |
Butyle(acetate de) |
n-Butyl acetate, analytical standard |
n-Butyl acetate, Semiconductor Grade |
Nat. Butyl Acetate |
Acetic acid n-butyl ester |
Acetic acid-n-Butyl Ester |
Acetic acid, butyl ester |
Butyl ester, acetic acid |
Butylester kyseliny octove [Czech] |
KSC175E2R |
1-Butanol, acetate |
7519AF |
Butyl Acetate (Fragrance Grade) |
Butyl Acetate (Industrial Grade) |
NSC9298 |
SCHEMBL14969 |
A0024 |
A0228 |
Butyl acetate, pharmaceutical secondary standard; traceable to USP |
CTK0H5228 |
HSDB 152 |
n-BUTYL ACETATE, ACS |
Butile (acetati di) |
Butyle (acetate de) |
CHEMBL284391 |
LS-684 |
n-Butyl acetate, ACS reagent |
n-Butyl acetate, HPLC Grade |
RL01088 |
Acetate de butyle [French] |
Acetic acid, n-butyl ester |
Butyl acetate, n- |
C12304 |
CCRIS 2287 |
inverted exclamation mark currency Acetic acid, n-butyl ester |
LTBB002235 |
n-Butyl acetate (natural) |
WLN: 4OV1 |
DTXSID3021982 |
NSC 9298 |
NSC-9298 |
Octan n-butylu [Polish] |
OR034245 |
OR210253 |
STL282735 |
A805161 |
Butyl acetate, anhydrous, >=99% |
Butyl acetate, United States Pharmacopeia (USP) Reference Standard |
CH3COO(CH2)3CH3 |
CHEBI:31328 |
DSSTox_CID_1982 |
ZINC1699905 |
AN-22929 |
ANW-18171 |
CJ-28646 |
DSSTox_GSID_21982 |
KB-65000 |
SC-19009 |
TRA0076315 |
DSSTox_RID_76441 |
MFCD00009445 |
ZINC01699905 |
464P5N1905 |
AI3-00406 |
KB-200664 |
RTR-003725 |
TR-003725 |
AKOS000120198 |
Butyl acetate, LR, >=98% |
J-004991 |
J-519958 |
Q-200771 |
BRN 1741921 |
Butile (acetati di) [Italian] |
FT-0621752 |
UNII-464P5N1905 |
Butyle (acetate de) [French] |
Butyl acetate, >=99.5%, suitable for atomic absorption spectrometry |
Butyl acetate, ampule of 100 mg |
Tox21_201052 |
123-86-4 |
Butyl acetate, natural, >=98%, FG |
F0001-0371 |
Butyl acetate, >=99%, FCC, FG |
Butyl acetate, ACS reagent, >=99.5% |
MCULE-2107021121 |
NCGC00091573-01 |
NCGC00091573-02 |
NCGC00258605-01 |
Butyl acetate, AR, 99.5% |
Butyl acetate, JIS special grade, >=99.0% |
CAS-123-86-4 |
EINECS 204-658-1 |
Butyl acetate, for HPLC, 99.7% |
Butyl acetate, SAJ first grade, >=98.0% |
Butyl acetate, puriss. p.a., ACS reagent |
Butyl acetate, ReagentPlus(R), 99.5% |
n-Butyl acetate, 99% 500ml |
7729-EP2269975A2 |
7729-EP2269986A1 |
7729-EP2269997A2 |
7729-EP2270009A1 |
7729-EP2270113A1 |
7729-EP2272822A1 |
7729-EP2272849A1 |
7729-EP2272935A1 |
7729-EP2274983A1 |
7729-EP2275407A1 |
7729-EP2275410A1 |
7729-EP2275411A2 |
7729-EP2275415A2 |
7729-EP2275469A1 |
7729-EP2277880A1 |
7729-EP2280000A1 |
7729-EP2280005A1 |
7729-EP2280274A2 |
7729-EP2281821A1 |
7729-EP2282200A2 |
7729-EP2283811A1 |
7729-EP2287152A2 |
7729-EP2287154A1 |
7729-EP2287940A1 |
7729-EP2289509A2 |
7729-EP2289884A1 |
7729-EP2289965A1 |
7729-EP2292597A1 |
7729-EP2292599A1 |
7729-EP2292610A1 |
7729-EP2295414A1 |
7729-EP2295417A1 |
7729-EP2295425A1 |
7729-EP2295438A1 |
7729-EP2298729A1 |
7729-EP2298753A1 |
7729-EP2298763A1 |
7729-EP2298828A1 |
7729-EP2301918A1 |
7729-EP2301983A1 |
7729-EP2302003A1 |
7729-EP2305667A2 |
7729-EP2305685A1 |
7729-EP2305686A1 |
7729-EP2308838A1 |
7729-EP2308857A1 |
7729-EP2308858A1 |
7729-EP2308872A1 |
7729-EP2308926A1 |
7729-EP2309564A1 |
7729-EP2311815A1 |
7729-EP2311816A1 |
7729-EP2311817A1 |
7729-EP2314558A1 |
7729-EP2316829A1 |
7729-EP2371831A1 |
7729-EP2374538A1 |
7729-EP2380568A1 |
7729-EP2380873A1 |
9295-EP2280014A2 |
9295-EP2287168A2 |
9295-EP2298772A1 |
9295-EP2305670A1 |
9295-EP2305676A1 |
9295-EP2305825A1 |
9295-EP2308839A1 |
9295-EP2308857A1 |
9295-EP2308872A1 |
9295-EP2309584A1 |
9295-EP2316829A1 |
MolPort-001-783-793 |
n-Butyl acetate [UN1123] [Flammable liquid] |
n-Butyl acetate [UN1123] [Flammable liquid] |
4-02-00-00143 (Beilstein Handbook Reference) |
InChI=1/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H |