Synonymous names |
Dimethylethylene glycol | Pseudobutylene glycol | Sym-dimethylethylene glycol | OWBTYPJTUOEWEK-UHFFFAOYSA-N | Dimethylene glycol | AC1Q2BQD | AC1L18UG | 2,3-Dihydroxybutane | ACMC-1BUD7 | KSC270E6J | ACMC-209euy | 2,3-butanodiol | 2,3-butanediol | 7110AF | HMDB03156 | 2,3-Butandiol | B0681 | CTK1H0264 | ACMC-209gb6 | 2,3-butylene glycol | 2,3-dihydroxy butane | 2,3-dihydroxy-butane | RL03891 | DL-2,3-Butanediol | A18844 | CCRIS 5501 | HSDB 1505 | D-2,3-BUTANEDIOL | CHEMBL2312529 | Butane-2,3-diol | OR035318 | OR332866 | OR094911 | DL-2,3-BUTANDIOL | DTXSID8041321 | 2,3- butanediol | NSC249246 | 2,3-butane diol | Butan-2,3-diol | CHEBI:62064 | SC-81338 | LS-45795 | levo-butane-2,3-diol | KB-67232 | SC-08971 | SC-08972 | DSSTox_GSID_41321 | ANW-41590 | AN-23501 | MFCD00004523 | DSSTox_CID_21321 | DSSTox_RID_79687 | 2D-PHARMALYTE (9CI) | TR-032024 | NSC-249246 | D-2,3-Butane diol | RTR-032024 | DB-027533 | AKOS009031391 | FT-0696715 | BRN 0969165 | I14-19052 | Z966690926 | 2,3-Butanediol (DL) | PROPOXY, 2-HYDROXY-1-METHYL- | Tox21_300789 | 2,3-Butanediol, 98% | 2,3-BUTANEDIOL, 96% | 513-85-9 | NCGC00248169-01 | NCGC00254693-01 | CAS-513-85-9 | EINECS 208-173-6 | 2,3-Butanediol, analytical standard, mixture of racemic and meso forms | 35007-63-7 | 98923-25-2 | 123513-85-9 | MolPort-003-927-421 | 2,3-Butanediol, Vetec(TM) reagent grade, 98% | 4-01-00-02524 (Beilstein Handbook Reference) | 2,3-Butanediol, [R-(R*,R*)]- | 2,3-Butanediol, purum, mixture of racemic and meso forms, >=98.0% (GC) | 2,3-Butanediol, puriss., mixture of racemic and meso forms, >=99.0% (GC) | 2,3-Butanediol, (R*,R*)-(.+/-.)- | InChI=1/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H |
|