(2S,3S,4S,5S)-2,3,5-trimethoxyoxan-4-ol
Compound Details
| Synonymous names |
| DMXCGRVMWGBEOK-XAMCCFCMSA-N | | Methyl-2,4-di-O-methyl.beta.l-arabinopyranoside |
|
| Microorganism: | Yes |
| IUPAC name | (2S,3S,4S,5S)-2,3,5-trimethoxyoxan-4-ol |
| SMILES | COC1COC(C(C1O)OC)OC |
| Inchi | InChI=1S/C8H16O5/c1-10-5-4-13-8(12-3)7(11-2)6(5)9/h5-9H,4H2,1-3H3/t5-,6-,7-,8-/m0/s1 |
| Formula | C8H16O5 |
| PubChem ID | 91697159 |
|
| Molweight | 192.21 |
| LogP | -0.9 |
| Atoms | 13 |
| Bonds | 3 |
| H-bond Acceptor | 5 |
| H-bond Donor | 1 |
| Chemical Classification | ethers heterocyclic compounds alcohols |
| Species emitting the compound | | Kingdom | Species | Biological Function | Origin/Habitat | Reference |
|---|
| Prokaryota | Bacillus Tequilensis | antifungal activity against the hyphae growth of Ceratocystis fimbriata | rhizosphere soil of a sweet potato variety (Xushu-36) from Xuzhou Academy of Agricultural Sciences in China in 2016 | Xu et al. 2021 |
|
| Method | | Kingdom | Species | Growth Medium | Applied Method | Verification |
|---|
| Prokaryota | Bacillus Tequilensis | LB media | HS-SPME/GC-MS | no |
|