| Synonymous names |
| 35065-28-2 | | 2,2',3,4,4',5'-HEXACHLOROBIPHENYL | | PCB 138 | | 2,2',3',4,4',5-Hexachlorobiphenyl | | 1,2,3-trichloro-4-(2,4,5-trichlorophenyl)benzene | | CCRIS 4039 | | PCB-138 | | 1,1'-Biphenyl, 2,2',3,4,4',5'-hexachloro- | | UNII-7Y6JIG1867 | | PCB138 | | 2,2,'3,4,4,'5'-Hexachlorobiphenyl | | 7Y6JIG1867 | | 1,1'-Biphenyl,2,2',3,4,4',5'-hexachloro- | | 2,3,4,2',4',5'-Hexachlorobiphenyl | | 2,2',3,4,4',5'-Hexachlorobiphenyl (IUPAC No. 138) | | DTXSID8038300 | | 2,2',3,4,4',5'-Hexachloro-1,1'-biphenyl | | 2,4,5,2',3',4'-hexachlorobiphenyl | | PCB No 138 | | PCB No. 138 | | PCB No. 138 100 microg/mL in Hexane | | PCB No. 138 10 microg/mL in Isooctane | | PCB No. 138 100 microg/mL in Isooctane | | CONTEST Group C Reduced | | SCHEMBL4459622 | | DTXCID6018300 | | 07D - Polychlorinated Biphenyls | | 19D - Polychlorinated Biphenyls | | CHEBI:165219 | | PCB No 138, analytical standard | | 1ST3737 | | 2,2',3,4,4',5'-Hexachlorbiphenyl | | NS00005294 | | 2,2',3,4,4',5'-Hexachloro-1,1'-biphenyl # | | J-019851 | | Q27269013 | | 2,2',3,4,4',5'-Hexachlorobiphenyl, 99%, vial of 25 mg, BZ# 138 | | 2,2',3,4,4',5'-Hexachlorobiphenyl (IUPAC No. 138), BCR(R) certified Reference Material | | 2,2',3,4,4',5'-Hexachlorobiphenyl, 99%, vial of 250 mg, BZ# 138, analytical standard | | InChI=1/C12H4Cl6/c13-7-2-1-5(11(17)12(7)18)6-3-9(15)10(16)4-8(6)14/h1-4 |
|