2-(1,3-benzodioxol-5-yl)-8-methoxy-3-nitro-2H-chromene
Species emitting the compound | |
Method | Kingdom | Species | Growth Medium | Applied Method | Verification |
---|
Eukaryota | Saccharomyces Cerevisiae | malt extract broth | HS-SPME with GC-MS | no |
|
2,4,5-trimethyl-1,3-dioxolane
Compound Details
Synonymous names |
2,4,5-Trimethyl-1,3-dioxolane | 3299-32-9 | 1,3-Dioxolane, 2,4,5-trimethyl- | EINECS 221-969-8 | SCHEMBL1936758 | SCHEMBL13469391 | CHEBI:87572 | DTXSID50863147 | 2,4,5-Trimethyl-1,3-dioxolane # | DB-279020 | NS00048945 | Q27159741 |
|
Microorganism: | No |
IUPAC name | 2,4,5-trimethyl-1,3-dioxolane |
SMILES | CC1C(OC(O1)C)C |
Inchi | InChI=1S/C6H12O2/c1-4-5(2)8-6(3)7-4/h4-6H,1-3H3 |
Formula | C6H12O2 |
PubChem ID | 102967 |
|
Molweight | 116.16 |
LogP | 1.1 |
Atoms | 8 |
Bonds | 0 |
H-bond Acceptor | 2 |
H-bond Donor | 0 |
Chemical Classification | ethers dioxolanes heterocyclic compounds |
CHEBI-ID | 87572 |
Supernatural-ID | SN0128703 |
Species emitting the compound | Kingdom | Species | Biological Function | Origin/Habitat | Reference |
---|
Eukaryota | Aspergillus Flavus | | ITEM collection of CNR-ISPA (Research National Council of Italy - Institute of Sciences of Food Production) in Bari, Italy | Josselin et al. 2021 |
|
Method | Kingdom | Species | Growth Medium | Applied Method | Verification |
---|
Eukaryota | Aspergillus Flavus | SNA media | SPME/GC-MS | no |
|
3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)propyl Benzoate
Compound Details
Synonymous names |
SCHEMBL14552282 | STHNKYXCDKGCJL-UHFFFAOYSA-N | 3-(6,7-Dimethoxy-1,3-benzodioxol-5-yl)propyl benzoate # | Benzoic acid, 3-(2,3-dimethoxy-4,5-methylenedioxyphenyl)propyl ester |
|
Microorganism: | No |
IUPAC name | 3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)propyl benzoate |
SMILES | COC1=C(C2=C(C=C1CCCOC(=O)C3=CC=CC=C3)OCO2)OC |
Inchi | InChI=1S/C19H20O6/c1-21-16-14(11-15-17(18(16)22-2)25-12-24-15)9-6-10-23-19(20)13-7-4-3-5-8-13/h3-5,7-8,11H,6,9-10,12H2,1-2H3 |
Formula | C19H20O6 |
PubChem ID | 570355 |
|
Molweight | 344.4 |
LogP | 3.8 |
Atoms | 25 |
Bonds | 8 |
H-bond Acceptor | 6 |
H-bond Donor | 0 |
Chemical Classification | aromatic compounds benzenoids dioxolanes esters ethers heterocyclic compounds |
Species emitting the compound | |
Method | Kingdom | Species | Growth Medium | Applied Method | Verification |
---|
| Aspergillus Niger | inoculated potato samples | GC-MS | no |
|
2-spiro[1,3-dioxolane-2,2'-3,4-dihydro-1H-naphthalene]-1'-ylethyl Acetate
Compound Details
Synonymous names |
Acetic acid, 2-(3',4'-dihydro-1'H-spiro[[1,3]dioxolane-2,2'-naphthalen]-1'-yl)ethyl ester | VOZBYQOWPIEZBH-UHFFFAOYSA-N |
|
Microorganism: | No |
IUPAC name | 2-spiro[1,3-dioxolane-2,2'-3,4-dihydro-1H-naphthalene]-1'-ylethyl acetate |
SMILES | CC(=O)OCCC1C2=CC=CC=C2CCC13OCCO3 |
Inchi | InChI=1S/C16H20O4/c1-12(17)18-9-7-15-14-5-3-2-4-13(14)6-8-16(15)19-10-11-20-16/h2-5,15H,6-11H2,1H3 |
Formula | C16H20O4 |
PubChem ID | 582618 |
|
Molweight | 276.33 |
LogP | 2.1 |
Atoms | 20 |
Bonds | 4 |
H-bond Acceptor | 4 |
H-bond Donor | 0 |
Chemical Classification | aromatic compounds benzenoids dioxolanes esters heterocyclic compounds |
Species emitting the compound | |
Method | Kingdom | Species | Growth Medium | Applied Method | Verification |
---|
| Aspergillus Flavus | inoculated potato samples | GC-MS | no |
|
[4-[2-[2-(chloromethyl)-1,3-dioxolan-2-yl]ethyl]phenyl] Acetate
Species emitting the compound | |
Method | Kingdom | Species | Growth Medium | Applied Method | Verification |
---|
| Aspergillus Niger | inoculated potato samples | GC-MS | no |
|
5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-15-one
Compound Details
Synonymous names |
1,2-Didehydrocrinan-3-one | SCHEMBL19529634 | LUMDZQACZMCPFS-UHFFFAOYSA-N |
|
Microorganism: | Yes |
IUPAC name | 5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-15-one |
SMILES | C1CN2CC3=CC4=C(C=C3C15C2CC(=O)C=C5)OCO4 |
Inchi | InChI=1S/C16H15NO3/c18-11-1-2-16-3-4-17(15(16)6-11)8-10-5-13-14(7-12(10)16)20-9-19-13/h1-2,5,7,15H,3-4,6,8-9H2 |
Formula | C16H15NO3 |
PubChem ID | 622836 |
|
Molweight | 269.29 |
LogP | 1.6 |
Atoms | 20 |
Bonds | 0 |
H-bond Acceptor | 4 |
H-bond Donor | 0 |
Chemical Classification | amines aromatic compounds benzenoids dioxolanes heterocyclic compounds ketones |
Supernatural-ID | SN0215758 |
Species emitting the compound | |
Method | |
6,11-dimethoxy-5-methyl-[1,3]dioxolo[4,5-b]acridin-10-one
Compound Details
Synonymous names |
Tecleanthine | Tecleanthin | 6,11-dimethoxy-5-methyl-[1,3]dioxolo[4,5-b]acridin-10-one | 1,3-Dioxolo[4,5-b]acridin-10(5H)-one, 6,11-dimethoxy-5-methyl- | CHEMBL455629 | QYWWGVQKWKTLMU-UHFFFAOYSA-N | 6,11-Dimethoxy-5-methyl[1,3]dioxolo[4,5-b]acridin-10(5H)-one # |
|
Microorganism: | No |
IUPAC name | 6,11-dimethoxy-5-methyl-[1,3]dioxolo[4,5-b]acridin-10-one |
SMILES | CN1C2=CC3=C(C(=C2C(=O)C4=C1C(=CC=C4)OC)OC)OCO3 |
Inchi | InChI=1S/C17H15NO5/c1-18-10-7-12-16(23-8-22-12)17(21-3)13(10)15(19)9-5-4-6-11(20-2)14(9)18/h4-7H,8H2,1-3H3 |
Formula | C17H15NO5 |
PubChem ID | 628642 |
|
Molweight | 313.3 |
LogP | 2.9 |
Atoms | 23 |
Bonds | 2 |
H-bond Acceptor | 6 |
H-bond Donor | 0 |
Chemical Classification | amines dioxolanes ethers heterocyclic compounds ketones nitrogen compounds |
Supernatural-ID | SN0318905 |
Species emitting the compound | |
Method | Kingdom | Species | Growth Medium | Applied Method | Verification |
---|
| Aspergillus Niger | inoculated potato samples | GC-MS | no |
|
(E)-3-(1,3-benzodioxol-5-yl)-1-quinolin-2-ylprop-2-en-1-one
Species emitting the compound | |
Method | Kingdom | Species | Growth Medium | Applied Method | Verification |
---|
| Aspergillus Flavus | inoculated potato samples | GC-MS | no |
|
7-methoxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-3,4-dihydrochromen-2-one
Compound Details
Synonymous names |
DLZIUZKXRJTQMV-UHFFFAOYSA-N | STL435524 | AKOS024289802 | 7-METHOXY-4-(7-METHOXY-1,3-BENZODIOXOL-5-YL)-2-CHROMANONE | 7-methoxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromen-2-one | 7-Methoxy-4-(7-methoxy-2H-1,3-benzodioxol-5-yl)-3,4-dihydro-1-benzopyran-2-one |
|
Microorganism: | Yes |
IUPAC name | 7-methoxy-4-(7-methoxy-1,3-benzodioxol-5-yl)-3,4-dihydrochromen-2-one |
SMILES | COC1=CC2=C(C=C1)C(CC(=O)O2)C3=CC4=C(C(=C3)OC)OCO4 |
Inchi | InChI=1S/C18H16O6/c1-20-11-3-4-12-13(8-17(19)24-14(12)7-11)10-5-15(21-2)18-16(6-10)22-9-23-18/h3-7,13H,8-9H2,1-2H3 |
Formula | C18H16O6 |
PubChem ID | 46949264 |
|
Molweight | 328.3 |
LogP | 2.9 |
Atoms | 24 |
Bonds | 3 |
H-bond Acceptor | 6 |
H-bond Donor | 0 |
Chemical Classification | aromatic compounds benzenoids dioxolanes esters ethers heterocyclic compounds lactones |
Species emitting the compound | |
Method | |