Compound - Results

Lornoxicam

Java required.


Information Structure
Name Lornoxicam
Synonyms
6-Chloro-4-hydroxy-2-methyl-N-2-pyridyl-2H-thieno(2,3-e)-1,2-thiazine-3-carboxamide 1,1-dioxide
BRN 1039965
Chlortenoxicam
CTX
Lornoxicam
Lornoxicamum
Ro 13-9297
ATC M01AC05
CID 54690031
CAS 070374399
Drugbank ID DB00675
SMILES CN1C(C(=O)NC2=CC=CC=N2)=C(O)C3=C(C=C(Cl)S3)S1(=O)=O
CYP interactions
NameRelationsReferences
2C9Substrate Inhibitor 14709614
15606435
15764711
16308280
15226678
10640513
10640513
8857077
Extrarenal fraction 1.0
Elimination half-life 4.0h