Compound - Results

Acetyldigoxin

Java required.


Information Structure
Name Acetyldigoxin
Synonyms
16-Acetyldigoxin
4-Acetyldigoxin
Acetyl-digoxin-beta
Acetyldigoxin
beta-Acetyldigoxin
Cardioreg
Cor-Puren
Digorid B
Digotab
Digoxigenin + Zuckerkette Wie Bei Acetyl-digitoxin-alpha
Digoxin Didier
EINECS 226-337-5
Hexamethyleneimine 3,5-dinitrobenzoate
Kardiamed
Longdigox
Novodigal
Stillacor
ATC C01AA02
CID 11765960
CAS 005355486
SMILES C[C@@H]1O[C@H](C[C@@H](O)[C@@H]1O[C@H]2C[C@@H](O)[C@@H](O[C@@H]3C[C@H](O)[C@H](OC(C)=O)[C@@H](C)O3)[C@H](C)O2)O[C@@H]4CC[C@]5(C)[C@H](CC[C@H]6[C@H]5C[C@@H](O)[C@]7(C)[C@@H](CC[C@]67O)C8=CC(=O)OC8)C4
Extrarenal fraction 0.3
Elimination half-life 36h