Compound - Results

Deferoxamine

Java required.


Information Structure
Name Deferoxamine
Synonyms
1-Amino-6,17-dihydroxy-7,10,18,21-tetraoxo-27-(N-acetyl Hydroxylamino)-6,11,17,22-tetraazaheptaeicosane
3,9,14,20,25-Pentaazatriacontane-2,10,13,21,24-pentone, 30-amino-3,14,25-trihydroxy-
30-Amino-3,14,25-trihydroxy-3,9,14,20,25-pentaazatriacontane-2,10,13,21,24-pentaone
Ba 33112
BRN 2514118
Deferoxamin
Deferoxamina
Deferoxamine
Deferoxamine B
Deferoxaminum
Deferrioxamine
Deferrioxamine B
Desferan
Desferex
Desferin
Desferral
Desferriferrioxamin B
Desferrin
Desferrioxamine
Desferrioxamine B
DF B
DFOM
EINECS 200-738-5
Ferrioxamine B, N-benzoyl-
HSDB 3311
N-(5-((4-((5-(Acetylhydroxamino)pentyl)amino)-1,4-dioxobutyl) Hydroxyamino)pentyl)-N-(5-aminopentyl)-N-hydroxybutanediamide
N-(5-(3-((5-Aminopentyl)hydroxycarbamoyl)propionamido)pentyl)-3-((5-(N-hydroxyacetamido)pentyl)carbamoyl)propionohydroxamic Acid
N-Benzoylferrioxamine B
NSC-527604
ATC V03AC01
CID 2973
CAS 000070519
Drugbank ID DB00746
SMILES CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN
Formula C25H48N6O8
Molweight 560.684
Atoms 39
LogP 2.4042
Rotatable Bonds 28
H-Bond Donors 0
H-Bond Acceptors 11
CYP interactions
NameRelationsReferences
1A1Inhibitor 10799651
Transporter
AC-No.NameReferences
B8ZZ39SLC19A3 20930543