Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Valeriansaeure
PubChem ID:7991
Pathway:Show KEGG pathways
InChI:InChI=1/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7)/f/h6H
SMILES:CCCCC(O)=O

Properties:
Formula:C5H10O2Atoms:7
Molecular Weight:102.132Rotatable Bonds:3
H-bond Acceptors:2H-bond Donors:0
logP:1.2612
Targets:
Synonyms:
1-Butanecarboxylic acid
109-52-4
110140_ALDRICH
12124-87-7
19455-21-1
19455-21-1 (potassium salt)
1ylv
4-02-00-00868 (Beilstein Handbook Reference)
42739-38-8
42739-38-8 (ammonium salt)
556-38-7
556-38-7 (zinc salt)
6106-41-8
6106-41-8 (hydrochloride salt)
70268-41-6
70268-41-6 (manganese(+2) salt)
75054_FLUKA
AB1002590
AC1L1Q0L
AG-D-26480
AI3-08657
AIDS-017600
AIDS017600
AKOS000118960
bmse000345
BRN 0969454
Butane-1-carboxylic acid
Butanecarboxylic acid
C00803
C5:0
CH3-[CH2]3-COOH
CHEBI:17418
CHEMBL268736
DB02406
DB04344
EINECS 203-677-2
FEMA No. 3101
HMS2267A03
HSDB 5390
I04-1052
Kyselina valerova
Kyselina valerova [Czech]
LAEVULINIC ACID
LEA
LEVULINIC ACID
LMFA01010005
LS-3150
MLS001066335
n-BuCOOH
n-Pentanoate
n-Pentanoic acid
n-Valeric acid
NCGC00183281-01
NCGC00183281-02
NSC 406833
NSC406833
PEI
Pentanic acid
Pentanoate
Pentanoic acid
Pentanoic acid Valeric acid
pentoic acid
Propylacetic acid
SBB053585
SHF
SMR000471834
V0003
Valerate
Valerianic acid
Valeriansaeure
Valeric acid
VALERIC ACID, N-
Valeric acid, normal
W310107_ALDRICH
WLN: QV4