Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:CLAVATADINE B
PubChem ID:24881874
Pathway:Show KEGG pathways
InChI:InChI=1S/C14H19Br2N5O4/c15-8-6-9(7(5-10(17)22)11(16)12(8)23)25-14(24)21-4-2-1-3-20-13(18)19/h6,23H,1-5H2,(H2,17,22)(H,21,24)(H4,18,19,20)
SMILES:NC(=NCCCCNC(=O)Oc1cc(Br)c(c(c1CC(=O)N)Br)O)N

Properties:
Formula:C14H19Br2N5O4Atoms:25
Molecular Weight:481.14Rotatable Bonds:10
H-bond Acceptors:9H-bond Donors:5
logP:3.5788
Targets:
NameUniprot IDSourceReferencesInteraction
Coagulation factor XIFA11_HUMANBindingDB-shows
Synonyms:
CHEBI:608383
CHEMBL486904
CLAVATADINE B