Compound Search

Compound search by properties:

Compound name: e.g. alitame
Pubchem ID: e.g. 10035228
Class: Carbohydrates or Other
Origin: natural
IUPAC: e.g. (2S,4R)-pentane-1,2,3,4,5-pentol
Smile (Canonical): e.g. [Na+].[O-]S(=O)(=O)NC1CCCCC1
Sweetness: between and e.g. 0.15 - 400
Molweight: between and e.g. 80 - 150
Atoms: between and e.g. 10 - 20
Rings: between and e.g. 2 - 4
Bonds: between and e.g. 50 - 100
Rotatable bonds: between and e.g. 10 - 15
H-bond donors: between and e.g. 0 - 5
H-bond acceptors: between and e.g. 0 - 5


Structure search by name and drawing tool:

np name: e.g. Neotame
SMILES: e.g. CC(=O)