Isopropylideneacetone |
Isopropylidene acetone |
Mesityloxyde |
Mesityloxid |
SHOJXDKTYKFBRD-UHFFFAOYSA-N |
Isobutenyl methyl ketone |
Methyl isobutenyl ketone |
MESITYL OXIDE |
Mesityl Oxide, pharmaceutical secondary standard |
Ossido di mesitile |
Oxyde de mesityle |
Acetone, isopropylidene- |
ACMC-1BOEP |
AC1L1RU7 |
AC1Q1JB3 |
Mesityloxid [German] |
Mesityloxyde [Dutch] |
KSC494O1D |
7471AF |
UN1229 |
2,2-Dimethylvinyl methyl ketone |
CTK3J4711 |
M0069 |
M1340 |
Methyl 2,2-dimethylvinyl ketone |
NSC38717 |
Ossido di mesitile [Italian] |
RP18648 |
HSDB 1195 |
Mesityl oxide, European Pharmacopoeia (EP) Reference Standard |
Oxyde de mesityle [French] |
3-Isohexen-2-one |
BBL027732 |
CHEMBL3185916 |
DTXSID1029170 |
FEMA Number 3368 |
Jsp002461 |
LS-2950 |
Methyl 2-methyl-1-propenyl ketone |
OR034477 |
OR219303 |
SBB040870 |
STL146350 |
UN 1229 |
A807813 |
CHEBI:89993 |
DSSTox_CID_9170 |
77LAC84669 |
AN-43889 |
ANW-41508 |
CJ-07569 |
CJ-32144 |
DSSTox_GSID_29170 |
KB-78313 |
NSC 38717 |
NSC-38717 |
SC-47106 |
TRA0020647 |
BB_NC-2260 |
Caswell No. 547 |
DSSTox_RID_78697 |
LMFA12000030 |
MFCD00008900 |
ZINC02038441 |
2-Methyl-2-pentenone-4 |
AI3-07702 |
Mesityl oxide, technical grade, 90% |
RTR-005373 |
TR-005373 |
UNII-77LAC84669 |
AKOS000118892 |
EPA Pesticide Chemical Code 052401 |
Mesityl oxide, mixture of alpha- and beta-isomers |
Q-201356 |
S14-1428 |
ZINC100019800 |
(CH3)2C=CHC(=O)CH3 |
BRN 1361550 |
FEMA No. 3368 |
FT-0628235 |
2-Methyl-4-oxo-2-pentene |
4-Methyl-3-pentene-2-one |
2-Methyl-2-penten-4-one |
2-methylpent-2-en-4-one |
4-Methyl-3-penten-2-on |
4-Methyl-3-penten-2-one |
4-Methylpent-3-en-2-one |
4-Metil-3-penten-2-one |
Tox21_202080 |
Tox21_303606 |
141-79-7 |
4-Methyl-3-penten-2-one, analytical reference material |
WLN: 1Y1 & U1V1 |
MCULE-4922478422 |
NCGC00249161-01 |
NCGC00257514-01 |
NCGC00259629-01 |
3-Penten-2-one,4-methyl- |
4-methyl-pent-3-en-2-one |
CAS-141-79-7 |
EINECS 205-502-5 |
3-PENTEN,2-ONE,4-METHYL MESITYLOXIDE |
Mesityl oxide [UN1229] [Flammable liquid] |
3-Penten-2-one, 4-methyl- |
MolPort-000-872-030 |
4-Methyl-3-penten-2-one, 9CI |
4-Metil-3-penten-2-one [Italian] |
Mesityl oxide, suitable for neutral marker for measuring electroosmotic flow (EOF), ~98% |
4-Methyl-3-penten-2-on(DUTCH, GERMAN) |
4-Methyl-3-penten-2-one, 90% |
Mesityl oxide [UN1229] [Flammable liquid] |
4-Methyl-3-penten-2-on [Dutch, German] |
Mesityl oxide, technical, 90%, remainder 4-methyl-4-penten-2-one 100ml |
InChI=1/C6H10O/c1-5(2)4-6(3)7/h4H,1-3H |