Synonymous names |
paraxylene | Scintillar | p-Dimethylbenzene | URLKBWYHVLBVBO-UHFFFAOYSA-N | Chromar | Dimethylbenzene,coking by-products | p-Methyltoluene | Solvent xylene | Para-Xylene | PXY | 4-Methyltoluene | p-Xylenes | AC1L1PLL | AC1Q2QRE | P-XYLENE | p-Xylol | ACMC-1BROJ | Xylene,coking b | 4-Xylene | p-Xylene, analytical standard | ScintiLene Cocktail | 1,4-Dimethylbenzene | 1,4-Dimethylbenzol | 187l | KSC175S8L | Xylene, p-isomer | CHEMBL31561 | 6WAC1O477V | Benzene, p-dimethyl- | CCRIS 910 | CTK0H5985 | HSDB 136 | S0649 | 1,4-dimethyl benzene | 1,4-Xylene | AS00254 | BENZENE,1,4-DIMETHYL | LS-397 | NSC72419 | RL01514 | RP18866 | Xylene, p- | A18069 | bmse000834 | C06756 | LTBB002309 | p-Xylene-13C8 | p-Xylene, pharmaceutical secondary standard; traceable to USP | UNII-6WAC1O477V | ZINC968254 | DTXSID2021868 | OR000302 | OR198617 | OR198618 | OR245569 | OR271024 | STL264212 | ZB015532 | CHEBI:27417 | DSSTox_CID_1868 | p-XYLENE- D10 | AN-22433 | ANW-15345 | CJ-04643 | DSSTox_GSID_21868 | LABOTEST-BB LTBB002309 | METHYL,(4-METHYLPHENYL)- | NSC 72419 | NSC-72419 | SC-65191 | SC-79143 | TRA0007876 | Aromatic hydrocarbons, C8, o-xylene-lean | BDBM50008567 | DSSTox_RID_76374 | MFCD00008556 | WLN: 1R D1 | ZINC00968254 | AI3-52255 | p-Xylene, anhydrous, >=99% | TC-104090 | TR-001252 | AKOS000121124 | I01-9720 | J-001588 | J-524068 | 1,4-Dimethylcyclohexane, mixture of cis and trans | Benzene, 1,4-dimethyl- | FT-0689271 | p-Xylene, for synthesis, 99% | Tox21_201113 | 106-42-3 | F0001-0120 | p-Xylene, for HPLC, >=99% | Benzene, 1,4-dimethyl-, oxidized | MCULE-3769448716 | NCGC00091661-01 | NCGC00091661-02 | NCGC00258665-01 | p-Xylene, ReagentPlus(R), 99% | CAS-106-42-3 | EINECS 203-396-5 | 68411-39-2 | 68650-36-2 | p-Xylene, 99% 100ml | p-Xylene, SAJ special grade, >=99.0% | MolPort-001-783-900 | p-Xylene, SAJ first grade, >=99.0% | p-Xylene [UN1307] [Flammable liquid] | 28306-EP2270003A1 | 28306-EP2277867A2 | 28306-EP2280003A2 | 28306-EP2289896A1 | 28306-EP2301918A1 | 28306-EP2305825A1 | 28306-EP2309584A1 | 28306-EP2314577A1 | 28306-EP2380568A1 | p-Xylene [UN1307] [Flammable liquid] | p-Xylene, purum, >=98.0% (GC) | p-Xylene, puriss. p.a., >=99.0% (GC) | InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H |
|