Synonymous names |
Anilinobenzene | Diphenylamine indicator | Styrenated diphenylamine | DIPHENYAMINE | Diphenylamine | N-PHENYLBENZENENAMINE | Phenylaniline | Difenylamin | Diphenylamine redox | N-Phenylbenzenamine | N-Phenylbenzeneamine | DMBHHRLKUKUOEG-UHFFFAOYSA-N | N-Phenylaniline | N-PhenylbenzenamineN-Phenyl AnilineDPAAnilinobenzene(phenylamino)benzeneN,N-diphenylaminebig dipperC.I. 10355PhenylbenzenamineDiphenylamine; | Scaldip | anilino-benzen | DIPHENYL AMINE | DIPHENYL-AMINE | N-Fenylanilin | N-Phenylbenzenamine, styrenated | phenyl aniline | Styrenated N-phenyl-benzenamine | (phenylamino)benzene | Big Dipper | DIPHENYLAMINE, ACS | N-Phenylaniline; N-Phenylbenzenamine | Poly(diphenylamine) | Shield DPA | AC1L1XGP | AC1Q2AQX | N,N-DIPHENYLAMINE | No scald | No-Scald | Styrene, reaction product with diphenylamine | 9N3CBB0BIQ | benzenamine,n-phenyl- | SCHEMBL229 | (phenylamino)-benzen | Difenylamin [Czech] | Diphenylamine, >=98% | Benzene, anilino- | Deccoscald 282 | N-(phenyl)aniline | N,N-di-phenylamine | Naugalube 428L | UNII-9N3CBB0BIQ | WLN: RMR | ACMC-20aj4p | ARONIS24999 | Benzenamine, N-phenyl- | CHEMBL38688 | CTK0H5366 | D0872 | Diphenylamine, PESTANAL(R), analytical standard | N-Fenylanilin [Czech] | QSPL 033 | S0706 | V0082 | Aniline, N-phenyl- | AS01428 | BIDD:ER0338 | Diphenylamine, p.a. | EBD25081 | LS-665 | NE10251 | RL01013 | Benzenamine, N-phenyl-, styrenated | C11016 | CCRIS 4699 | CHEBI:4640 | HMS1788N11 | HMS3034E05 | HSDB 1108 | ZINC967716 | Benzene, (phenylamino)- | Diphenylamine, ACS reagent, >=99% | DTXSID4021975 | NSC215210 | OR034342 | SBB058673 | SCHEMBL3685153 | SCHEMBL6255037 | SCHEMBL7527678 | STK301666 | ZB015473 | A804887 | Diphenylamine, ACS 25g | DSSTox_CID_1975 | AB1003196 | AC-16417 | AJ-24540 | AK-49326 | AN-43432 | C6H5-NH-C6H5 | CI 10355 | DSSTox_GSID_21975 | KB-50142 | LABOTEST-BB LTBB000505 | LS-28419 | No-Scald DPA 283 | SC-19016 | SCHEMBL10932134 | ATTERCOP-CHM AT130117 | Caswell No. 398 | Diphenylamine, reaction product with 2,2,4-trimethylpentene | DSSTox_RID_76436 | MFCD00003014 | ZINC00967716 | AI3-00781 | Diphenylamine, ReagentPlus(R), 99% | NSC 215210 | NSC-215210 | RTR-003590 | ST45053747 | TR-003590 | AKOS000119099 | EPA Pesticide Chemical Code 038501 | Epitope ID:115002 | J-004797 | J-520383 | Oprea1_815288 | FT-0625252 | FT-0632429 | FT-0636419 | MLS002152913 | SMR000777939 | I14-17974 | LABOTEST-BB LT03328529 | Tox21_201611 | Tox21_301026 | 122-39-4 | Diphenylamine, Vetec(TM) reagent grade, 98% | F2190-0411 | C.I. 10355 | MCULE-8347316415 | NCGC00090889-01 | NCGC00090889-02 | NCGC00090889-03 | NCGC00090889-04 | NCGC00090889-05 | NCGC00254928-01 | NCGC00259160-01 | CAS-122-39-4 | EINECS 204-539-4 | EINECS 270-485-3 | 68442-68-2 | 86352-05-8 | MolPort-001-641-019 | Diphenylamine, puriss. p.a., redox indicator, ACS reagent, reag. Ph. Eur., >=98% (GC) | InChI=1/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13 |
|